C12H7N5O8 — CID 631601
2,4,6-trinitro-N-(4-nitrophenyl)aniline (PubChem CID 631601) has the molecular formula C12H7N5O8 and a molecular weight of 349.22 g/mol. Its IUPAC name is 2,4,6-trinitro-N-(4-nitrophenyl)aniline.
| Compound Name | 2,4,6-trinitro-N-(4-nitrophenyl)aniline |
|---|---|
| PubChem CID | 631601 |
| Molecular Formula | C12H7N5O8 |
| Molecular Weight | 349.22 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | 2,4,6-trinitro-N-(4-nitrophenyl)aniline |
| SMILES | O=[N+]([O-])c1ccc(Nc2c([N+](=O)[O-])cc([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H7N5O8/c18-14(19)8-3-1-7(2-4-8)13-12-10(16(22)23)5-9(15(20)21)6-11(12)17(24)25/h1-6,13H |
| InChIKey | XPASUWOQXAHESL-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 184.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.22 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|