About N-naphthalen-1-yl-4-(2,4,6-trinitroanilino)benzamide
N-naphthalen-1-yl-4-(2,4,6-trinitroanilino)benzamide (PubChem CID 2840888) has the molecular formula C23H15N5O7
and a molecular weight of 473.40 g/mol. Its IUPAC name is N-naphthalen-1-yl-4-(2,4,6-trinitroanilino)benzamide.
Molecular Properties
| Compound Name | N-naphthalen-1-yl-4-(2,4,6-trinitroanilino)benzamide |
| PubChem CID | 2840888 |
| Molecular Formula | C23H15N5O7 |
| Molecular Weight | 473.40 g/mol |
| Exact Mass | 473.10 |
| IUPAC Name | N-naphthalen-1-yl-4-(2,4,6-trinitroanilino)benzamide |
| SMILES | O=C(Nc1cccc2ccccc12)c1ccc(Nc2c([N+](=O)[O-])cc([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H15N5O7/c29-23(25-19-7-3-5-14-4-1-2-6-18(14)19)15-8-10-16(11-9-15)24-22-20(27(32)33)12-17(26(30)31)13-21(22)28(34)35/h1-13,24H,(H,25,29) |
| InChIKey | RRACZJGTAGNTOO-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 170.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 473.40 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-naphthalen-1-yl-4-(2,4,6-trinitroanilino)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-naphthalen-1-yl-4-(2,4,6-trinitroanilino)benzamide?
The IUPAC name of N-naphthalen-1-yl-4-(2,4,6-trinitroanilino)benzamide (CID 2840888) is N-naphthalen-1-yl-4-(2,4,6-trinitroanilino)benzamide.
What is the SMILES notation for N-naphthalen-1-yl-4-(2,4,6-trinitroanilino)benzamide?
The canonical SMILES for N-naphthalen-1-yl-4-(2,4,6-trinitroanilino)benzamide is O=C(Nc1cccc2ccccc12)c1ccc(Nc2c([N+](=O)[O-])cc([N+](=O)[O-])cc2[N+](=O)[O-])cc1.
What is the InChIKey of N-naphthalen-1-yl-4-(2,4,6-trinitroanilino)benzamide?
The InChIKey is RRACZJGTAGNTOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H15N5O7/c29-23(25-19-7-3-5-14-4-1-2-6-18(14)19)15-8-10-16(11-9-15)24-22-20(27(32)33)12-17(26(30)31)13-21(22)28(34)35/h1-13,24H,(H,25,29).
What are the key properties of N-naphthalen-1-yl-4-(2,4,6-trinitroanilino)benzamide?
N-naphthalen-1-yl-4-(2,4,6-trinitroanilino)benzamide has a molecular weight of 473.40 g/mol, XLogP of 5.56, 7 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N-naphthalen-1-yl-4-(2,4,6-trinitroanilino)benzamide is sourced from PubChem (CID 2840888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).