C23H15N5O7 — CID 2840888
N-naphthalen-1-yl-4-(2,4,6-trinitroanilino)benzamide (PubChem CID 2840888) has the molecular formula C23H15N5O7 and a molecular weight of 473.40 g/mol. Its IUPAC name is N-naphthalen-1-yl-4-(2,4,6-trinitroanilino)benzamide.
| Compound Name | N-naphthalen-1-yl-4-(2,4,6-trinitroanilino)benzamide |
|---|---|
| PubChem CID | 2840888 |
| Molecular Formula | C23H15N5O7 |
| Molecular Weight | 473.40 g/mol |
| Exact Mass | 473.10 |
| IUPAC Name | N-naphthalen-1-yl-4-(2,4,6-trinitroanilino)benzamide |
| SMILES | O=C(Nc1cccc2ccccc12)c1ccc(Nc2c([N+](=O)[O-])cc([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H15N5O7/c29-23(25-19-7-3-5-14-4-1-2-6-18(14)19)15-8-10-16(11-9-15)24-22-20(27(32)33)12-17(26(30)31)13-21(22)28(34)35/h1-13,24H,(H,25,29) |
| InChIKey | RRACZJGTAGNTOO-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 170.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.40 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|