C13H11N5O5 — CID 132593734
4-anilino-3,5-dinitrobenzohydrazide (PubChem CID 132593734) has the molecular formula C13H11N5O5 and a molecular weight of 317.26 g/mol. Its IUPAC name is 4-anilino-3,5-dinitrobenzohydrazide.
| Compound Name | 4-anilino-3,5-dinitrobenzohydrazide |
|---|---|
| PubChem CID | 132593734 |
| Molecular Formula | C13H11N5O5 |
| Molecular Weight | 317.26 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 4-anilino-3,5-dinitrobenzohydrazide |
| SMILES | NNC(=O)c1cc([N+](=O)[O-])c(Nc2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H11N5O5/c14-16-13(19)8-6-10(17(20)21)12(11(7-8)18(22)23)15-9-4-2-1-3-5-9/h1-7,15H,14H2,(H,16,19) |
| InChIKey | ANMNELWRQTYXGY-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 153.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.26 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|