C15H12ClN3O5 — CID 132591591
4-(4-ethylanilino)-3,5-dinitrobenzoyl chloride (PubChem CID 132591591) has the molecular formula C15H12ClN3O5 and a molecular weight of 349.73 g/mol. Its IUPAC name is 4-(4-ethylanilino)-3,5-dinitrobenzoyl chloride.
| Compound Name | 4-(4-ethylanilino)-3,5-dinitrobenzoyl chloride |
|---|---|
| PubChem CID | 132591591 |
| Molecular Formula | C15H12ClN3O5 |
| Molecular Weight | 349.73 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | 4-(4-ethylanilino)-3,5-dinitrobenzoyl chloride |
| SMILES | CCc1ccc(Nc2c([N+](=O)[O-])cc(C(=O)Cl)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H12ClN3O5/c1-2-9-3-5-11(6-4-9)17-14-12(18(21)22)7-10(15(16)20)8-13(14)19(23)24/h3-8,17H,2H2,1H3 |
| InChIKey | AXSXEEHJRCVMTH-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 115.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.73 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|