C14H9N5O7 — CID 4170370
methyl 4-[(5,7-dinitro-2,1,3-benzoxadiazol-4-yl)amino]benzoate (PubChem CID 4170370) has the molecular formula C14H9N5O7 and a molecular weight of 359.25 g/mol. Its IUPAC name is methyl 4-[(5,7-dinitro-2,1,3-benzoxadiazol-4-yl)amino]benzoate.
| Compound Name | methyl 4-[(5,7-dinitro-2,1,3-benzoxadiazol-4-yl)amino]benzoate |
|---|---|
| PubChem CID | 4170370 |
| Molecular Formula | C14H9N5O7 |
| Molecular Weight | 359.25 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | methyl 4-[(5,7-dinitro-2,1,3-benzoxadiazol-4-yl)amino]benzoate |
| SMILES | COC(=O)c1ccc(Nc2c([N+](=O)[O-])cc([N+](=O)[O-])c3nonc23)cc1 |
| InChI | InChI=1S/C14H9N5O7/c1-25-14(20)7-2-4-8(5-3-7)15-11-9(18(21)22)6-10(19(23)24)12-13(11)17-26-16-12/h2-6,15H,1H3 |
| InChIKey | KOJWOUXYLFATTD-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 163.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.25 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|