C13H8N6O7 — CID 3826854
N-(2-methyl-4-nitrophenyl)-5,7-dinitro-2,1,3-benzoxadiazol-4-amine (PubChem CID 3826854) has the molecular formula C13H8N6O7 and a molecular weight of 360.24 g/mol. Its IUPAC name is N-(2-methyl-4-nitrophenyl)-5,7-dinitro-2,1,3-benzoxadiazol-4-amine.
| Compound Name | N-(2-methyl-4-nitrophenyl)-5,7-dinitro-2,1,3-benzoxadiazol-4-amine |
|---|---|
| PubChem CID | 3826854 |
| Molecular Formula | C13H8N6O7 |
| Molecular Weight | 360.24 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | N-(2-methyl-4-nitrophenyl)-5,7-dinitro-2,1,3-benzoxadiazol-4-amine |
| SMILES | Cc1cc([N+](=O)[O-])ccc1Nc1c([N+](=O)[O-])cc([N+](=O)[O-])c2nonc12 |
| InChI | InChI=1S/C13H8N6O7/c1-6-4-7(17(20)21)2-3-8(6)14-11-9(18(22)23)5-10(19(24)25)12-13(11)16-26-15-12/h2-5,14H,1H3 |
| InChIKey | CJLNZMLXXPXHEP-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 180.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.24 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|