C10H11N5O5 — CID 4564824
N-tert-butyl-5,7-dinitro-2,1,3-benzoxadiazol-4-amine (PubChem CID 4564824) has the molecular formula C10H11N5O5 and a molecular weight of 281.23 g/mol. Its IUPAC name is N-tert-butyl-5,7-dinitro-2,1,3-benzoxadiazol-4-amine.
| Compound Name | N-tert-butyl-5,7-dinitro-2,1,3-benzoxadiazol-4-amine |
|---|---|
| PubChem CID | 4564824 |
| Molecular Formula | C10H11N5O5 |
| Molecular Weight | 281.23 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | N-tert-butyl-5,7-dinitro-2,1,3-benzoxadiazol-4-amine |
| SMILES | CC(C)(C)Nc1c([N+](=O)[O-])cc([N+](=O)[O-])c2nonc12 |
| InChI | InChI=1S/C10H11N5O5/c1-10(2,3)11-7-5(14(16)17)4-6(15(18)19)8-9(7)13-20-12-8/h4,11H,1-3H3 |
| InChIKey | PGSQOOMYZGYHRF-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 137.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.23 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|