About N-(3-bromophenyl)-5,7-dinitro-2,1,3-benzoxadiazol-4-amine
N-(3-bromophenyl)-5,7-dinitro-2,1,3-benzoxadiazol-4-amine (PubChem CID 22706673) has the molecular formula C12H6BrN5O5
and a molecular weight of 380.11 g/mol. Its IUPAC name is N-(3-bromophenyl)-5,7-dinitro-2,1,3-benzoxadiazol-4-amine.
Molecular Properties
| Compound Name | N-(3-bromophenyl)-5,7-dinitro-2,1,3-benzoxadiazol-4-amine |
| PubChem CID | 22706673 |
| Molecular Formula | C12H6BrN5O5 |
| Molecular Weight | 380.11 g/mol |
| Exact Mass | 378.96 |
| IUPAC Name | N-(3-bromophenyl)-5,7-dinitro-2,1,3-benzoxadiazol-4-amine |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c2nonc2c1Nc1cccc(Br)c1 |
| InChI | InChI=1S/C12H6BrN5O5/c13-6-2-1-3-7(4-6)14-10-8(17(19)20)5-9(18(21)22)11-12(10)16-23-15-11/h1-5,14H |
| InChIKey | CBQUYYJVJWIBJS-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 137.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.11 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(3-bromophenyl)-5,7-dinitro-2,1,3-benzoxadiazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-bromophenyl)-5,7-dinitro-2,1,3-benzoxadiazol-4-amine?
The IUPAC name of N-(3-bromophenyl)-5,7-dinitro-2,1,3-benzoxadiazol-4-amine (CID 22706673) is N-(3-bromophenyl)-5,7-dinitro-2,1,3-benzoxadiazol-4-amine.
What is the SMILES notation for N-(3-bromophenyl)-5,7-dinitro-2,1,3-benzoxadiazol-4-amine?
The canonical SMILES for N-(3-bromophenyl)-5,7-dinitro-2,1,3-benzoxadiazol-4-amine is O=[N+]([O-])c1cc([N+](=O)[O-])c2nonc2c1Nc1cccc(Br)c1.
What is the InChIKey of N-(3-bromophenyl)-5,7-dinitro-2,1,3-benzoxadiazol-4-amine?
The InChIKey is CBQUYYJVJWIBJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6BrN5O5/c13-6-2-1-3-7(4-6)14-10-8(17(19)20)5-9(18(21)22)11-12(10)16-23-15-11/h1-5,14H.
What are the key properties of N-(3-bromophenyl)-5,7-dinitro-2,1,3-benzoxadiazol-4-amine?
N-(3-bromophenyl)-5,7-dinitro-2,1,3-benzoxadiazol-4-amine has a molecular weight of 380.11 g/mol, XLogP of 3.55, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-bromophenyl)-5,7-dinitro-2,1,3-benzoxadiazol-4-amine is sourced from PubChem (CID 22706673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).