C12H9N5O7 — CID 3808908
3-(3-amino-2,4,6-trinitroanilino)phenol (PubChem CID 3808908) has the molecular formula C12H9N5O7 and a molecular weight of 335.23 g/mol. Its IUPAC name is 3-(3-amino-2,4,6-trinitroanilino)phenol.
| Compound Name | 3-(3-amino-2,4,6-trinitroanilino)phenol |
|---|---|
| PubChem CID | 3808908 |
| Molecular Formula | C12H9N5O7 |
| Molecular Weight | 335.23 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | 3-(3-amino-2,4,6-trinitroanilino)phenol |
| SMILES | Nc1c([N+](=O)[O-])cc([N+](=O)[O-])c(Nc2cccc(O)c2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H9N5O7/c13-10-8(15(19)20)5-9(16(21)22)11(12(10)17(23)24)14-6-2-1-3-7(18)4-6/h1-5,14,18H,13H2 |
| InChIKey | WECXZTJZTKRMFL-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 187.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.23 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|