C18H12N6O8 — CID 102533464
1-N,3-N-bis(2,6-dinitrophenyl)benzene-1,3-diamine (PubChem CID 102533464) has the molecular formula C18H12N6O8 and a molecular weight of 440.33 g/mol. Its IUPAC name is 1-N,3-N-bis(2,6-dinitrophenyl)benzene-1,3-diamine.
| Compound Name | 1-N,3-N-bis(2,6-dinitrophenyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 102533464 |
| Molecular Formula | C18H12N6O8 |
| Molecular Weight | 440.33 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | 1-N,3-N-bis(2,6-dinitrophenyl)benzene-1,3-diamine |
| SMILES | O=[N+]([O-])c1cccc([N+](=O)[O-])c1Nc1cccc(Nc2c([N+](=O)[O-])cccc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H12N6O8/c25-21(26)13-6-2-7-14(22(27)28)17(13)19-11-4-1-5-12(10-11)20-18-15(23(29)30)8-3-9-16(18)24(31)32/h1-10,19-20H |
| InChIKey | YNCUHYIENXMMRC-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 196.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.33 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|