C14H7F5N4O7 — CID 20554521
2,4,6-trinitro-N-[3-(1,1,2,2,2-pentafluoroethoxy)phenyl]aniline (PubChem CID 20554521) has the molecular formula C14H7F5N4O7 and a molecular weight of 438.22 g/mol. Its IUPAC name is 2,4,6-trinitro-N-[3-(1,1,2,2,2-pentafluoroethoxy)phenyl]aniline.
| Compound Name | 2,4,6-trinitro-N-[3-(1,1,2,2,2-pentafluoroethoxy)phenyl]aniline |
|---|---|
| PubChem CID | 20554521 |
| Molecular Formula | C14H7F5N4O7 |
| Molecular Weight | 438.22 g/mol |
| Exact Mass | 438.02 |
| IUPAC Name | 2,4,6-trinitro-N-[3-(1,1,2,2,2-pentafluoroethoxy)phenyl]aniline |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(Nc2cccc(OC(F)(F)C(F)(F)F)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H7F5N4O7/c15-13(16,17)14(18,19)30-9-3-1-2-7(4-9)20-12-10(22(26)27)5-8(21(24)25)6-11(12)23(28)29/h1-6,20H |
| InChIKey | VYRFSCZAKSARGV-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 150.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.22 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|