C13H7ClF3N3O4 — CID 22769746
N-(2-chlorophenyl)-2,4-dinitro-6-(trifluoromethyl)aniline (PubChem CID 22769746) has the molecular formula C13H7ClF3N3O4 and a molecular weight of 361.66 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2,4-dinitro-6-(trifluoromethyl)aniline.
| Compound Name | N-(2-chlorophenyl)-2,4-dinitro-6-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 22769746 |
| Molecular Formula | C13H7ClF3N3O4 |
| Molecular Weight | 361.66 g/mol |
| Exact Mass | 361.01 |
| IUPAC Name | N-(2-chlorophenyl)-2,4-dinitro-6-(trifluoromethyl)aniline |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(Nc2ccccc2Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H7ClF3N3O4/c14-9-3-1-2-4-10(9)18-12-8(13(15,16)17)5-7(19(21)22)6-11(12)20(23)24/h1-6,18H |
| InChIKey | JCDPOMPZQBGZPA-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.66 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|