C17H7Br2F3IN3O4 — CID 88683422
2,4-dibromo-N-[2,4-dinitro-6-(trifluoromethyl)phenyl]-3-iodonaphthalen-1-amine (PubChem CID 88683422) has the molecular formula C17H7Br2F3IN3O4 and a molecular weight of 660.97 g/mol. Its IUPAC name is 2,4-dibromo-N-[2,4-dinitro-6-(trifluoromethyl)phenyl]-3-iodonaphthalen-1-amine.
| Compound Name | 2,4-dibromo-N-[2,4-dinitro-6-(trifluoromethyl)phenyl]-3-iodonaphthalen-1-amine |
|---|---|
| PubChem CID | 88683422 |
| Molecular Formula | C17H7Br2F3IN3O4 |
| Molecular Weight | 660.97 g/mol |
| Exact Mass | 658.78 |
| IUPAC Name | 2,4-dibromo-N-[2,4-dinitro-6-(trifluoromethyl)phenyl]-3-iodonaphthalen-1-amine |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(Nc2c(Br)c(I)c(Br)c3ccccc23)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H7Br2F3IN3O4/c18-12-8-3-1-2-4-9(8)15(13(19)14(12)23)24-16-10(17(20,21)22)5-7(25(27)28)6-11(16)26(29)30/h1-6,24H |
| InChIKey | LVTDWMMHJWEECB-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.97 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|