C17H7ClF6N6O4 — CID 168879848
6-chloro-N-[2,4-dinitro-6-(trifluoromethyl)phenyl]-2-pyridin-2-yl-5-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 168879848) has the molecular formula C17H7ClF6N6O4 and a molecular weight of 508.72 g/mol. Its IUPAC name is 6-chloro-N-[2,4-dinitro-6-(trifluoromethyl)phenyl]-2-pyridin-2-yl-5-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | 6-chloro-N-[2,4-dinitro-6-(trifluoromethyl)phenyl]-2-pyridin-2-yl-5-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 168879848 |
| Molecular Formula | C17H7ClF6N6O4 |
| Molecular Weight | 508.72 g/mol |
| Exact Mass | 508.01 |
| IUPAC Name | 6-chloro-N-[2,4-dinitro-6-(trifluoromethyl)phenyl]-2-pyridin-2-yl-5-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(Nc2nc(-c3ccccn3)nc(Cl)c2C(F)(F)F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H7ClF6N6O4/c18-13-11(17(22,23)24)15(28-14(27-13)9-3-1-2-4-25-9)26-12-8(16(19,20)21)5-7(29(31)32)6-10(12)30(33)34/h1-6H,(H,26,27,28) |
| InChIKey | PXLSUYLZGYLWFN-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 136.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.72 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|