C12H6F6N2 — CID 122219942
4-pyridin-2-yl-2,6-bis(trifluoromethyl)pyridine (PubChem CID 122219942) has the molecular formula C12H6F6N2 and a molecular weight of 292.18 g/mol. Its IUPAC name is 4-pyridin-2-yl-2,6-bis(trifluoromethyl)pyridine.
| Compound Name | 4-pyridin-2-yl-2,6-bis(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 122219942 |
| Molecular Formula | C12H6F6N2 |
| Molecular Weight | 292.18 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | 4-pyridin-2-yl-2,6-bis(trifluoromethyl)pyridine |
| SMILES | FC(F)(F)c1cc(-c2ccccn2)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C12H6F6N2/c13-11(14,15)9-5-7(8-3-1-2-4-19-8)6-10(20-9)12(16,17)18/h1-6H |
| InChIKey | ZFIKSSXCZJOZLB-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.18 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |