C22H14F3N3 — CID 58672250
2,6-dipyridin-2-yl-4-[4-(trifluoromethyl)phenyl]pyridine (PubChem CID 58672250) has the molecular formula C22H14F3N3 and a molecular weight of 377.37 g/mol. Its IUPAC name is 2,6-dipyridin-2-yl-4-[4-(trifluoromethyl)phenyl]pyridine.
| Compound Name | 2,6-dipyridin-2-yl-4-[4-(trifluoromethyl)phenyl]pyridine |
|---|---|
| PubChem CID | 58672250 |
| Molecular Formula | C22H14F3N3 |
| Molecular Weight | 377.37 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | 2,6-dipyridin-2-yl-4-[4-(trifluoromethyl)phenyl]pyridine |
| SMILES | FC(F)(F)c1ccc(-c2cc(-c3ccccn3)nc(-c3ccccn3)c2)cc1 |
| InChI | InChI=1S/C22H14F3N3/c23-22(24,25)17-9-7-15(8-10-17)16-13-20(18-5-1-3-11-26-18)28-21(14-16)19-6-2-4-12-27-19/h1-14H |
| InChIKey | SOVQGAAIYQEFEH-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.37 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |