C22H17Cl2N3Pt — CID 165430889
chloroplatinum(1+);4-(4-methylphenyl)-2,6-dipyridin-2-ylpyridine;chloride (PubChem CID 165430889) has the molecular formula C22H17Cl2N3Pt and a molecular weight of 589.38 g/mol. Its IUPAC name is chloroplatinum(1+);4-(4-methylphenyl)-2,6-dipyridin-2-ylpyridine;chloride.
| Compound Name | chloroplatinum(1+);4-(4-methylphenyl)-2,6-dipyridin-2-ylpyridine;chloride |
|---|---|
| PubChem CID | 165430889 |
| Molecular Formula | C22H17Cl2N3Pt |
| Molecular Weight | 589.38 g/mol |
| Exact Mass | 588.04 |
| IUPAC Name | chloroplatinum(1+);4-(4-methylphenyl)-2,6-dipyridin-2-ylpyridine;chloride |
| SMILES | Cc1ccc(-c2cc(-c3ccccn3)nc(-c3ccccn3)c2)cc1.Cl[Pt+].[Cl-] |
| InChI | InChI=1S/C22H17N3.2ClH.Pt/c1-16-8-10-17(11-9-16)18-14-21(19-6-2-4-12-23-19)25-22(15-18)20-7-3-5-13-24-20;;;/h2-15H,1H3;2*1H;/q;;;+2/p-2 |
| InChIKey | UWAUJHRZLKCPPX-UHFFFAOYSA-L |
| XLogP | 2.87 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.38 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |