C21H14ClN3 — CID 10871645
4-(4-chlorophenyl)-2,6-dipyridin-2-ylpyridine (PubChem CID 10871645) has the molecular formula C21H14ClN3 and a molecular weight of 343.82 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-2,6-dipyridin-2-ylpyridine.
| Compound Name | 4-(4-chlorophenyl)-2,6-dipyridin-2-ylpyridine |
|---|---|
| PubChem CID | 10871645 |
| Molecular Formula | C21H14ClN3 |
| Molecular Weight | 343.82 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 4-(4-chlorophenyl)-2,6-dipyridin-2-ylpyridine |
| SMILES | Clc1ccc(-c2cc(-c3ccccn3)nc(-c3ccccn3)c2)cc1 |
| InChI | InChI=1S/C21H14ClN3/c22-17-9-7-15(8-10-17)16-13-20(18-5-1-3-11-23-18)25-21(14-16)19-6-2-4-12-24-19/h1-14H |
| InChIKey | UPOMZZQMFGCHGB-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.82 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |