C24H23N3 — CID 142185712
ethane;4-(4-methylphenyl)-2,6-dipyridin-2-ylpyridine (PubChem CID 142185712) has the molecular formula C24H23N3 and a molecular weight of 353.47 g/mol. Its IUPAC name is ethane;4-(4-methylphenyl)-2,6-dipyridin-2-ylpyridine.
| Compound Name | ethane;4-(4-methylphenyl)-2,6-dipyridin-2-ylpyridine |
|---|---|
| PubChem CID | 142185712 |
| Molecular Formula | C24H23N3 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | ethane;4-(4-methylphenyl)-2,6-dipyridin-2-ylpyridine |
| SMILES | CC.Cc1ccc(-c2cc(-c3ccccn3)nc(-c3ccccn3)c2)cc1 |
| InChI | InChI=1S/C22H17N3.C2H6/c1-16-8-10-17(11-9-16)18-14-21(19-6-2-4-12-23-19)25-22(15-18)20-7-3-5-13-24-20;1-2/h2-15H,1H3;1-2H3 |
| InChIKey | ZGROFISLOYZWJJ-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |