C28H21N3S — CID 132837741
4-[4-(4-methylsulfanylphenyl)phenyl]-2,6-dipyridin-2-ylpyridine (PubChem CID 132837741) has the molecular formula C28H21N3S and a molecular weight of 431.56 g/mol. Its IUPAC name is 4-[4-(4-methylsulfanylphenyl)phenyl]-2,6-dipyridin-2-ylpyridine.
| Compound Name | 4-[4-(4-methylsulfanylphenyl)phenyl]-2,6-dipyridin-2-ylpyridine |
|---|---|
| PubChem CID | 132837741 |
| Molecular Formula | C28H21N3S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | 4-[4-(4-methylsulfanylphenyl)phenyl]-2,6-dipyridin-2-ylpyridine |
| SMILES | CSc1ccc(-c2ccc(-c3cc(-c4ccccn4)nc(-c4ccccn4)c3)cc2)cc1 |
| InChI | InChI=1S/C28H21N3S/c1-32-24-14-12-21(13-15-24)20-8-10-22(11-9-20)23-18-27(25-6-2-4-16-29-25)31-28(19-23)26-7-3-5-17-30-26/h2-19H,1H3 |
| InChIKey | CPFUNDWPSBIWHZ-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |