C24H19NS — CID 11078715
4-(4-methylsulfanylphenyl)-2,6-diphenylpyridine (PubChem CID 11078715) has the molecular formula C24H19NS and a molecular weight of 353.49 g/mol. Its IUPAC name is 4-(4-methylsulfanylphenyl)-2,6-diphenylpyridine.
| Compound Name | 4-(4-methylsulfanylphenyl)-2,6-diphenylpyridine |
|---|---|
| PubChem CID | 11078715 |
| Molecular Formula | C24H19NS |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | 4-(4-methylsulfanylphenyl)-2,6-diphenylpyridine |
| SMILES | CSc1ccc(-c2cc(-c3ccccc3)nc(-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C24H19NS/c1-26-22-14-12-18(13-15-22)21-16-23(19-8-4-2-5-9-19)25-24(17-21)20-10-6-3-7-11-20/h2-17H,1H3 |
| InChIKey | MRXCAXIJQLBZGY-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |