C23H19N3 — CID 102129587
4-(3,4-dimethylphenyl)-2,6-dipyridin-2-ylpyridine (PubChem CID 102129587) has the molecular formula C23H19N3 and a molecular weight of 337.43 g/mol. Its IUPAC name is 4-(3,4-dimethylphenyl)-2,6-dipyridin-2-ylpyridine.
| Compound Name | 4-(3,4-dimethylphenyl)-2,6-dipyridin-2-ylpyridine |
|---|---|
| PubChem CID | 102129587 |
| Molecular Formula | C23H19N3 |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 4-(3,4-dimethylphenyl)-2,6-dipyridin-2-ylpyridine |
| SMILES | Cc1ccc(-c2cc(-c3ccccn3)nc(-c3ccccn3)c2)cc1C |
| InChI | InChI=1S/C23H19N3/c1-16-9-10-18(13-17(16)2)19-14-22(20-7-3-5-11-24-20)26-23(15-19)21-8-4-6-12-25-21/h3-15H,1-2H3 |
| InChIKey | XIMUKQRRRZJNNV-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |