C15H10ClN3Pt — CID 87267165
4-chloro-2,6-dipyridin-2-ylpyridine;platinum (PubChem CID 87267165) has the molecular formula C15H10ClN3Pt and a molecular weight of 462.80 g/mol. Its IUPAC name is 4-chloro-2,6-dipyridin-2-ylpyridine;platinum.
| Compound Name | 4-chloro-2,6-dipyridin-2-ylpyridine;platinum |
|---|---|
| PubChem CID | 87267165 |
| Molecular Formula | C15H10ClN3Pt |
| Molecular Weight | 462.80 g/mol |
| Exact Mass | 462.02 |
| IUPAC Name | 4-chloro-2,6-dipyridin-2-ylpyridine;platinum |
| SMILES | Clc1cc(-c2ccccn2)nc(-c2ccccn2)c1.[Pt] |
| InChI | InChI=1S/C15H10ClN3.Pt/c16-11-9-14(12-5-1-3-7-17-12)19-15(10-11)13-6-2-4-8-18-13;/h1-10H; |
| InChIKey | KFFDHXAYQGPRTL-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.80 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |