About 2-(4-chloro-2-pyridinyl)-6-pyridin-2-ylpyridine;platinum(2+);bis(pyrimidine-2-thiolate)
2-(4-chloro-2-pyridinyl)-6-pyridin-2-ylpyridine;platinum(2+);bis(pyrimidine-2-thiolate) (PubChem CID 173276782) has the molecular formula C23H16ClN7PtS2
and a molecular weight of 685.10 g/mol. Its IUPAC name is 2-(4-chloro-2-pyridinyl)-6-pyridin-2-ylpyridine;platinum(2+);bis(pyrimidine-2-thiolate).
Molecular Properties
| Compound Name | 2-(4-chloro-2-pyridinyl)-6-pyridin-2-ylpyridine;platinum(2+);bis(pyrimidine-2-thiolate) |
| PubChem CID | 173276782 |
| Molecular Formula | C23H16ClN7PtS2 |
| Molecular Weight | 685.10 g/mol |
| Exact Mass | 684.02 |
| IUPAC Name | 2-(4-chloro-2-pyridinyl)-6-pyridin-2-ylpyridine;platinum(2+);bis(pyrimidine-2-thiolate) |
| SMILES | Clc1ccnc(-c2cccc(-c3ccccn3)n2)c1.[Pt+2].[S-]c1ncccn1.[S-]c1ncccn1 |
| InChI | InChI=1S/C15H10ClN3.2C4H4N2S.Pt/c16-11-7-9-18-15(10-11)14-6-3-5-13(19-14)12-4-1-2-8-17-12;2*7-4-5-2-1-3-6-4;/h1-10H;2*1-3H,(H,5,6,7);/q;;;+2/p-2 |
| InChIKey | ONORGJSAINYPFM-UHFFFAOYSA-L |
| XLogP | 4.62 |
| TPSA | 90.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 685.10 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-chloro-2-pyridinyl)-6-pyridin-2-ylpyridine;platinum(2+);bis(pyrimidine-2-thiolate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chloro-2-pyridinyl)-6-pyridin-2-ylpyridine;platinum(2+);bis(pyrimidine-2-thiolate)?
The IUPAC name of 2-(4-chloro-2-pyridinyl)-6-pyridin-2-ylpyridine;platinum(2+);bis(pyrimidine-2-thiolate) (CID 173276782) is 2-(4-chloro-2-pyridinyl)-6-pyridin-2-ylpyridine;platinum(2+);bis(pyrimidine-2-thiolate).
What is the SMILES notation for 2-(4-chloro-2-pyridinyl)-6-pyridin-2-ylpyridine;platinum(2+);bis(pyrimidine-2-thiolate)?
The canonical SMILES for 2-(4-chloro-2-pyridinyl)-6-pyridin-2-ylpyridine;platinum(2+);bis(pyrimidine-2-thiolate) is Clc1ccnc(-c2cccc(-c3ccccn3)n2)c1.[Pt+2].[S-]c1ncccn1.[S-]c1ncccn1.
What is the InChIKey of 2-(4-chloro-2-pyridinyl)-6-pyridin-2-ylpyridine;platinum(2+);bis(pyrimidine-2-thiolate)?
The InChIKey is ONORGJSAINYPFM-UHFFFAOYSA-L. The full InChI is InChI=1S/C15H10ClN3.2C4H4N2S.Pt/c16-11-7-9-18-15(10-11)14-6-3-5-13(19-14)12-4-1-2-8-17-12;2*7-4-5-2-1-3-6-4;/h1-10H;2*1-3H,(H,5,6,7);/q;;;+2/p-2.
What are the key properties of 2-(4-chloro-2-pyridinyl)-6-pyridin-2-ylpyridine;platinum(2+);bis(pyrimidine-2-thiolate)?
2-(4-chloro-2-pyridinyl)-6-pyridin-2-ylpyridine;platinum(2+);bis(pyrimidine-2-thiolate) has a molecular weight of 685.10 g/mol, XLogP of 4.62, 2 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chloro-2-pyridinyl)-6-pyridin-2-ylpyridine;platinum(2+);bis(pyrimidine-2-thiolate) is sourced from PubChem (CID 173276782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).