C17H11F3N2 — CID 135069582
2-phenyl-6-pyridin-2-yl-4-(trifluoromethyl)pyridine (PubChem CID 135069582) has the molecular formula C17H11F3N2 and a molecular weight of 300.28 g/mol. Its IUPAC name is 2-phenyl-6-pyridin-2-yl-4-(trifluoromethyl)pyridine.
| Compound Name | 2-phenyl-6-pyridin-2-yl-4-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 135069582 |
| Molecular Formula | C17H11F3N2 |
| Molecular Weight | 300.28 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 2-phenyl-6-pyridin-2-yl-4-(trifluoromethyl)pyridine |
| SMILES | FC(F)(F)c1cc(-c2ccccc2)nc(-c2ccccn2)c1 |
| InChI | InChI=1S/C17H11F3N2/c18-17(19,20)13-10-15(12-6-2-1-3-7-12)22-16(11-13)14-8-4-5-9-21-14/h1-11H |
| InChIKey | DVHZNYQKSNLPGP-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.28 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |