C14H14F3N3S — CID 134115580
4-tert-butylsulfanyl-2-pyridin-2-yl-6-(trifluoromethyl)pyrimidine (PubChem CID 134115580) has the molecular formula C14H14F3N3S and a molecular weight of 313.35 g/mol. Its IUPAC name is 4-tert-butylsulfanyl-2-pyridin-2-yl-6-(trifluoromethyl)pyrimidine.
| Compound Name | 4-tert-butylsulfanyl-2-pyridin-2-yl-6-(trifluoromethyl)pyrimidine |
|---|---|
| PubChem CID | 134115580 |
| Molecular Formula | C14H14F3N3S |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 4-tert-butylsulfanyl-2-pyridin-2-yl-6-(trifluoromethyl)pyrimidine |
| SMILES | CC(C)(C)Sc1cc(C(F)(F)F)nc(-c2ccccn2)n1 |
| InChI | InChI=1S/C14H14F3N3S/c1-13(2,3)21-11-8-10(14(15,16)17)19-12(20-11)9-6-4-5-7-18-9/h4-8H,1-3H3 |
| InChIKey | VAXFCUPQMHLEFA-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |