C43H29N5 — CID 118582537
4-(3,5-dipyridin-2-ylphenyl)-2,6-bis(4-pyridin-2-ylphenyl)pyridine (PubChem CID 118582537) has the molecular formula C43H29N5 and a molecular weight of 615.74 g/mol. Its IUPAC name is 4-(3,5-dipyridin-2-ylphenyl)-2,6-bis(4-pyridin-2-ylphenyl)pyridine.
| Compound Name | 4-(3,5-dipyridin-2-ylphenyl)-2,6-bis(4-pyridin-2-ylphenyl)pyridine |
|---|---|
| PubChem CID | 118582537 |
| Molecular Formula | C43H29N5 |
| Molecular Weight | 615.74 g/mol |
| Exact Mass | 615.24 |
| IUPAC Name | 4-(3,5-dipyridin-2-ylphenyl)-2,6-bis(4-pyridin-2-ylphenyl)pyridine |
| SMILES | c1ccc(-c2ccc(-c3cc(-c4cc(-c5ccccn5)cc(-c5ccccn5)c4)cc(-c4ccc(-c5ccccn5)cc4)n3)cc2)nc1 |
| InChI | InChI=1S/C43H29N5/c1-5-21-44-38(9-1)30-13-17-32(18-14-30)42-28-35(29-43(48-42)33-19-15-31(16-20-33)39-10-2-6-22-45-39)34-25-36(40-11-3-7-23-46-40)27-37(26-34)41-12-4-8-24-47-41/h1-29H |
| InChIKey | MOTNRKXJXQGFDR-UHFFFAOYSA-N |
| XLogP | 10.33 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.74 |
| LogP ≤ 5 | 10.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |