C15H11N7O4 — CID 2846765
3,5-dinitro-2-N,6-N-dipyridin-2-ylpyridine-2,6-diamine (PubChem CID 2846765) has the molecular formula C15H11N7O4 and a molecular weight of 353.30 g/mol. Its IUPAC name is 3,5-dinitro-2-N,6-N-dipyridin-2-ylpyridine-2,6-diamine.
| Compound Name | 3,5-dinitro-2-N,6-N-dipyridin-2-ylpyridine-2,6-diamine |
|---|---|
| PubChem CID | 2846765 |
| Molecular Formula | C15H11N7O4 |
| Molecular Weight | 353.30 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 3,5-dinitro-2-N,6-N-dipyridin-2-ylpyridine-2,6-diamine |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(Nc2ccccn2)nc1Nc1ccccn1 |
| InChI | InChI=1S/C15H11N7O4/c23-21(24)10-9-11(22(25)26)15(19-13-6-2-4-8-17-13)20-14(10)18-12-5-1-3-7-16-12/h1-9H,(H2,16,17,18,19,20) |
| InChIKey | YAENEARBFRCEEJ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 149.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.30 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|