C17H12N6O5 — CID 4027518
3,5-dinitro-N-pyridin-2-yl-2-(pyridin-2-ylamino)benzamide (PubChem CID 4027518) has the molecular formula C17H12N6O5 and a molecular weight of 380.32 g/mol. Its IUPAC name is 3,5-dinitro-N-pyridin-2-yl-2-(pyridin-2-ylamino)benzamide.
| Compound Name | 3,5-dinitro-N-pyridin-2-yl-2-(pyridin-2-ylamino)benzamide |
|---|---|
| PubChem CID | 4027518 |
| Molecular Formula | C17H12N6O5 |
| Molecular Weight | 380.32 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 3,5-dinitro-N-pyridin-2-yl-2-(pyridin-2-ylamino)benzamide |
| SMILES | O=C(Nc1ccccn1)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1Nc1ccccn1 |
| InChI | InChI=1S/C17H12N6O5/c24-17(21-15-6-2-4-8-19-15)12-9-11(22(25)26)10-13(23(27)28)16(12)20-14-5-1-3-7-18-14/h1-10H,(H,18,20)(H,19,21,24) |
| InChIKey | VOSMTMQIIFYFQJ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 153.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.32 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|