C18H13N5O4 — CID 3383086
5-nitro-1-N,3-N-dipyridin-2-ylbenzene-1,3-dicarboxamide (PubChem CID 3383086) has the molecular formula C18H13N5O4 and a molecular weight of 363.33 g/mol. Its IUPAC name is 5-nitro-1-N,3-N-dipyridin-2-ylbenzene-1,3-dicarboxamide.
| Compound Name | 5-nitro-1-N,3-N-dipyridin-2-ylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 3383086 |
| Molecular Formula | C18H13N5O4 |
| Molecular Weight | 363.33 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | 5-nitro-1-N,3-N-dipyridin-2-ylbenzene-1,3-dicarboxamide |
| SMILES | O=C(Nc1ccccn1)c1cc(C(=O)Nc2ccccn2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H13N5O4/c24-17(21-15-5-1-3-7-19-15)12-9-13(11-14(10-12)23(26)27)18(25)22-16-6-2-4-8-20-16/h1-11H,(H,19,21,24)(H,20,22,25) |
| InChIKey | LKWBGSGLFSWXOM-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 127.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.33 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|