About ethane;methyl 3-[(3-hydroxy-2-pyridinyl)carbamoyl]-5-nitrobenzoate
ethane;methyl 3-[(3-hydroxy-2-pyridinyl)carbamoyl]-5-nitrobenzoate (PubChem CID 143408545) has the molecular formula C16H17N3O6
and a molecular weight of 347.33 g/mol. Its IUPAC name is ethane;methyl 3-[(3-hydroxy-2-pyridinyl)carbamoyl]-5-nitrobenzoate.
Molecular Properties
| Compound Name | ethane;methyl 3-[(3-hydroxy-2-pyridinyl)carbamoyl]-5-nitrobenzoate |
| PubChem CID | 143408545 |
| Molecular Formula | C16H17N3O6 |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | ethane;methyl 3-[(3-hydroxy-2-pyridinyl)carbamoyl]-5-nitrobenzoate |
| SMILES | CC.COC(=O)c1cc(C(=O)Nc2ncccc2O)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H11N3O6.C2H6/c1-23-14(20)9-5-8(6-10(7-9)17(21)22)13(19)16-12-11(18)3-2-4-15-12;1-2/h2-7,18H,1H3,(H,15,16,19);1-2H3 |
| InChIKey | QXVZEBWOYJEYFW-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 131.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;methyl 3-[(3-hydroxy-2-pyridinyl)carbamoyl]-5-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methyl 3-[(3-hydroxy-2-pyridinyl)carbamoyl]-5-nitrobenzoate?
The IUPAC name of ethane;methyl 3-[(3-hydroxy-2-pyridinyl)carbamoyl]-5-nitrobenzoate (CID 143408545) is ethane;methyl 3-[(3-hydroxy-2-pyridinyl)carbamoyl]-5-nitrobenzoate.
What is the SMILES notation for ethane;methyl 3-[(3-hydroxy-2-pyridinyl)carbamoyl]-5-nitrobenzoate?
The canonical SMILES for ethane;methyl 3-[(3-hydroxy-2-pyridinyl)carbamoyl]-5-nitrobenzoate is CC.COC(=O)c1cc(C(=O)Nc2ncccc2O)cc([N+](=O)[O-])c1.
What is the InChIKey of ethane;methyl 3-[(3-hydroxy-2-pyridinyl)carbamoyl]-5-nitrobenzoate?
The InChIKey is QXVZEBWOYJEYFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N3O6.C2H6/c1-23-14(20)9-5-8(6-10(7-9)17(21)22)13(19)16-12-11(18)3-2-4-15-12;1-2/h2-7,18H,1H3,(H,15,16,19);1-2H3.
What are the key properties of ethane;methyl 3-[(3-hydroxy-2-pyridinyl)carbamoyl]-5-nitrobenzoate?
ethane;methyl 3-[(3-hydroxy-2-pyridinyl)carbamoyl]-5-nitrobenzoate has a molecular weight of 347.33 g/mol, XLogP of 2.76, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methyl 3-[(3-hydroxy-2-pyridinyl)carbamoyl]-5-nitrobenzoate is sourced from PubChem (CID 143408545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).