C12H7N5O8 — CID 110496009
N-(3-hydroxy-5-nitro-2-pyridinyl)-3,5-dinitrobenzamide (PubChem CID 110496009) has the molecular formula C12H7N5O8 and a molecular weight of 349.22 g/mol. Its IUPAC name is N-(3-hydroxy-5-nitro-2-pyridinyl)-3,5-dinitrobenzamide.
| Compound Name | N-(3-hydroxy-5-nitro-2-pyridinyl)-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 110496009 |
| Molecular Formula | C12H7N5O8 |
| Molecular Weight | 349.22 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | N-(3-hydroxy-5-nitro-2-pyridinyl)-3,5-dinitrobenzamide |
| SMILES | O=C(Nc1ncc([N+](=O)[O-])cc1O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H7N5O8/c18-10-4-9(17(24)25)5-13-11(10)14-12(19)6-1-7(15(20)21)3-8(2-6)16(22)23/h1-5,18H,(H,13,14,19) |
| InChIKey | OHVLHWFADCSBOA-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 191.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.22 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|