C20H9Cl6N3O4 — CID 3379159
5-nitro-1-N,3-N-bis(2,4,5-trichlorophenyl)benzene-1,3-dicarboxamide (PubChem CID 3379159) has the molecular formula C20H9Cl6N3O4 and a molecular weight of 568.03 g/mol. Its IUPAC name is 5-nitro-1-N,3-N-bis(2,4,5-trichlorophenyl)benzene-1,3-dicarboxamide.
| Compound Name | 5-nitro-1-N,3-N-bis(2,4,5-trichlorophenyl)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 3379159 |
| Molecular Formula | C20H9Cl6N3O4 |
| Molecular Weight | 568.03 g/mol |
| Exact Mass | 564.87 |
| IUPAC Name | 5-nitro-1-N,3-N-bis(2,4,5-trichlorophenyl)benzene-1,3-dicarboxamide |
| SMILES | O=C(Nc1cc(Cl)c(Cl)cc1Cl)c1cc(C(=O)Nc2cc(Cl)c(Cl)cc2Cl)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H9Cl6N3O4/c21-11-4-15(25)17(6-13(11)23)27-19(30)8-1-9(3-10(2-8)29(32)33)20(31)28-18-7-14(24)12(22)5-16(18)26/h1-7H,(H,27,30)(H,28,31) |
| InChIKey | CFVVEHAKLZKPKG-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.03 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|