C20H13F2N3O4 — CID 2873591
1-N,3-N-bis(2-fluorophenyl)-5-nitrobenzene-1,3-dicarboxamide (PubChem CID 2873591) has the molecular formula C20H13F2N3O4 and a molecular weight of 397.34 g/mol. Its IUPAC name is 1-N,3-N-bis(2-fluorophenyl)-5-nitrobenzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis(2-fluorophenyl)-5-nitrobenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 2873591 |
| Molecular Formula | C20H13F2N3O4 |
| Molecular Weight | 397.34 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | 1-N,3-N-bis(2-fluorophenyl)-5-nitrobenzene-1,3-dicarboxamide |
| SMILES | O=C(Nc1ccccc1F)c1cc(C(=O)Nc2ccccc2F)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H13F2N3O4/c21-15-5-1-3-7-17(15)23-19(26)12-9-13(11-14(10-12)25(28)29)20(27)24-18-8-4-2-6-16(18)22/h1-11H,(H,23,26)(H,24,27) |
| InChIKey | UKXXKWNQCQLOQY-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.34 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|