C13H10N4O6 — CID 110496018
N-(3-hydroxy-5-nitro-2-pyridinyl)-2-(2-nitrophenyl)acetamide (PubChem CID 110496018) has the molecular formula C13H10N4O6 and a molecular weight of 318.25 g/mol. Its IUPAC name is N-(3-hydroxy-5-nitro-2-pyridinyl)-2-(2-nitrophenyl)acetamide.
| Compound Name | N-(3-hydroxy-5-nitro-2-pyridinyl)-2-(2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 110496018 |
| Molecular Formula | C13H10N4O6 |
| Molecular Weight | 318.25 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | N-(3-hydroxy-5-nitro-2-pyridinyl)-2-(2-nitrophenyl)acetamide |
| SMILES | O=C(Cc1ccccc1[N+](=O)[O-])Nc1ncc([N+](=O)[O-])cc1O |
| InChI | InChI=1S/C13H10N4O6/c18-11-6-9(16(20)21)7-14-13(11)15-12(19)5-8-3-1-2-4-10(8)17(22)23/h1-4,6-7,18H,5H2,(H,14,15,19) |
| InChIKey | NRDBGSQEVKFXLI-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 148.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.25 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|