C12H8Br2N4O3 — CID 103756213
N-(3,5-dibromopyrazin-2-yl)-2-(2-nitrophenyl)acetamide (PubChem CID 103756213) has the molecular formula C12H8Br2N4O3 and a molecular weight of 416.03 g/mol. Its IUPAC name is N-(3,5-dibromopyrazin-2-yl)-2-(2-nitrophenyl)acetamide.
| Compound Name | N-(3,5-dibromopyrazin-2-yl)-2-(2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 103756213 |
| Molecular Formula | C12H8Br2N4O3 |
| Molecular Weight | 416.03 g/mol |
| Exact Mass | 413.90 |
| IUPAC Name | N-(3,5-dibromopyrazin-2-yl)-2-(2-nitrophenyl)acetamide |
| SMILES | O=C(Cc1ccccc1[N+](=O)[O-])Nc1ncc(Br)nc1Br |
| InChI | InChI=1S/C12H8Br2N4O3/c13-9-6-15-12(11(14)16-9)17-10(19)5-7-3-1-2-4-8(7)18(20)21/h1-4,6H,5H2,(H,15,17,19) |
| InChIKey | VKEZZZYLDHWFRF-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.03 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|