C23H16N6O5 — CID 139072422
3,5-dinitro-N-(tripyridin-2-ylmethyl)benzamide (PubChem CID 139072422) has the molecular formula C23H16N6O5 and a molecular weight of 456.42 g/mol. Its IUPAC name is 3,5-dinitro-N-(tripyridin-2-ylmethyl)benzamide.
| Compound Name | 3,5-dinitro-N-(tripyridin-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 139072422 |
| Molecular Formula | C23H16N6O5 |
| Molecular Weight | 456.42 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | 3,5-dinitro-N-(tripyridin-2-ylmethyl)benzamide |
| SMILES | O=C(NC(c1ccccn1)(c1ccccn1)c1ccccn1)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H16N6O5/c30-22(16-13-17(28(31)32)15-18(14-16)29(33)34)27-23(19-7-1-4-10-24-19,20-8-2-5-11-25-20)21-9-3-6-12-26-21/h1-15H,(H,27,30) |
| InChIKey | HKRBISXQXWAISD-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 154.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.42 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|