C13H14N4O2 — CID 37104675
N-(2-nitrophenyl)-N'-pyridin-2-ylethane-1,2-diamine (PubChem CID 37104675) has the molecular formula C13H14N4O2 and a molecular weight of 258.28 g/mol. Its IUPAC name is N-(2-nitrophenyl)-N'-pyridin-2-ylethane-1,2-diamine.
| Compound Name | N-(2-nitrophenyl)-N'-pyridin-2-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 37104675 |
| Molecular Formula | C13H14N4O2 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | N-(2-nitrophenyl)-N'-pyridin-2-ylethane-1,2-diamine |
| SMILES | O=[N+]([O-])c1ccccc1NCCNc1ccccn1 |
| InChI | InChI=1S/C13H14N4O2/c18-17(19)12-6-2-1-5-11(12)14-9-10-16-13-7-3-4-8-15-13/h1-8,14H,9-10H2,(H,15,16) |
| InChIKey | HVBFRULICWSCRP-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 80.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|