C13H13FN4O2 — CID 47121117
N-(4-fluoro-2-nitrophenyl)-N'-pyridin-2-ylethane-1,2-diamine (PubChem CID 47121117) has the molecular formula C13H13FN4O2 and a molecular weight of 276.27 g/mol. Its IUPAC name is N-(4-fluoro-2-nitrophenyl)-N'-pyridin-2-ylethane-1,2-diamine.
| Compound Name | N-(4-fluoro-2-nitrophenyl)-N'-pyridin-2-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 47121117 |
| Molecular Formula | C13H13FN4O2 |
| Molecular Weight | 276.27 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | N-(4-fluoro-2-nitrophenyl)-N'-pyridin-2-ylethane-1,2-diamine |
| SMILES | O=[N+]([O-])c1cc(F)ccc1NCCNc1ccccn1 |
| InChI | InChI=1S/C13H13FN4O2/c14-10-4-5-11(12(9-10)18(19)20)15-7-8-17-13-3-1-2-6-16-13/h1-6,9,15H,7-8H2,(H,16,17) |
| InChIKey | VQJQRPRQVHUOMY-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 80.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.27 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|