C11H11FN4O2 — CID 114449288
4-fluoro-N-[2-(1H-imidazol-2-yl)ethyl]-2-nitroaniline (PubChem CID 114449288) has the molecular formula C11H11FN4O2 and a molecular weight of 250.23 g/mol. Its IUPAC name is 4-fluoro-N-[2-(1H-imidazol-2-yl)ethyl]-2-nitroaniline.
| Compound Name | 4-fluoro-N-[2-(1H-imidazol-2-yl)ethyl]-2-nitroaniline |
|---|---|
| PubChem CID | 114449288 |
| Molecular Formula | C11H11FN4O2 |
| Molecular Weight | 250.23 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 4-fluoro-N-[2-(1H-imidazol-2-yl)ethyl]-2-nitroaniline |
| SMILES | O=[N+]([O-])c1cc(F)ccc1NCCc1ncc[nH]1 |
| InChI | InChI=1S/C11H11FN4O2/c12-8-1-2-9(10(7-8)16(17)18)13-4-3-11-14-5-6-15-11/h1-2,5-7,13H,3-4H2,(H,14,15) |
| InChIKey | IRMWJXPTUYTMHJ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 83.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.23 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|