C16H13FN4O2S — CID 154750254
4-fluoro-2-nitro-N-[2-(4-pyridin-4-yl-1,3-thiazol-2-yl)ethyl]aniline (PubChem CID 154750254) has the molecular formula C16H13FN4O2S and a molecular weight of 344.37 g/mol. Its IUPAC name is 4-fluoro-2-nitro-N-[2-(4-pyridin-4-yl-1,3-thiazol-2-yl)ethyl]aniline.
| Compound Name | 4-fluoro-2-nitro-N-[2-(4-pyridin-4-yl-1,3-thiazol-2-yl)ethyl]aniline |
|---|---|
| PubChem CID | 154750254 |
| Molecular Formula | C16H13FN4O2S |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 4-fluoro-2-nitro-N-[2-(4-pyridin-4-yl-1,3-thiazol-2-yl)ethyl]aniline |
| SMILES | O=[N+]([O-])c1cc(F)ccc1NCCc1nc(-c2ccncc2)cs1 |
| InChI | InChI=1S/C16H13FN4O2S/c17-12-1-2-13(15(9-12)21(22)23)19-8-5-16-20-14(10-24-16)11-3-6-18-7-4-11/h1-4,6-7,9-10,19H,5,8H2 |
| InChIKey | IZKNKZKKARFPCP-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|