C10H7FN4O3S — CID 62787167
2-amino-N-(4-fluoro-2-nitrophenyl)-1,3-thiazole-4-carboxamide (PubChem CID 62787167) has the molecular formula C10H7FN4O3S and a molecular weight of 282.26 g/mol. Its IUPAC name is 2-amino-N-(4-fluoro-2-nitrophenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-amino-N-(4-fluoro-2-nitrophenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 62787167 |
| Molecular Formula | C10H7FN4O3S |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.02 |
| IUPAC Name | 2-amino-N-(4-fluoro-2-nitrophenyl)-1,3-thiazole-4-carboxamide |
| SMILES | Nc1nc(C(=O)Nc2ccc(F)cc2[N+](=O)[O-])cs1 |
| InChI | InChI=1S/C10H7FN4O3S/c11-5-1-2-6(8(3-5)15(17)18)13-9(16)7-4-19-10(12)14-7/h1-4H,(H2,12,14)(H,13,16) |
| InChIKey | KADOSTYUDRDPAF-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 111.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|