C10H8N4O4S — CID 107680867
2-amino-N-(2-hydroxy-6-nitrophenyl)-1,3-thiazole-4-carboxamide (PubChem CID 107680867) has the molecular formula C10H8N4O4S and a molecular weight of 280.26 g/mol. Its IUPAC name is 2-amino-N-(2-hydroxy-6-nitrophenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-amino-N-(2-hydroxy-6-nitrophenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 107680867 |
| Molecular Formula | C10H8N4O4S |
| Molecular Weight | 280.26 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | 2-amino-N-(2-hydroxy-6-nitrophenyl)-1,3-thiazole-4-carboxamide |
| SMILES | Nc1nc(C(=O)Nc2c(O)cccc2[N+](=O)[O-])cs1 |
| InChI | InChI=1S/C10H8N4O4S/c11-10-12-5(4-19-10)9(16)13-8-6(14(17)18)2-1-3-7(8)15/h1-4,15H,(H2,11,12)(H,13,16) |
| InChIKey | ZPNXUKIRKJSOJY-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 131.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.26 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|