2-[(2-amino-1,3-thiazole-4-carbonyl)amino]-3-bromobenzoic acid

C11H8BrN3O3S — CID 55176539

IUPAC2-[(2-amino-1,3-thiazole-4-carbonyl)amino]-3-bromobenzoic acid
SMILESNc1nc(C(=O)Nc2c(Br)cccc2C(=O)O)cs1
InChIInChI=1S/C11H8BrN3O3S/c12-6-3-1-2-5(10(17)18)8(6)15-9(16)7-4-19-11(13)14-7/h1-4H,(H2,13,14)(H,15,16)(H,17,18)
InChIKeyBAFARHFOQBVSNQ-UHFFFAOYSA-N
MW342.17 g/mol
LogP2.44
Rot. Bonds3

About 2-[(2-amino-1,3-thiazole-4-carbonyl)amino]-3-bromobenzoic acid

2-[(2-amino-1,3-thiazole-4-carbonyl)amino]-3-bromobenzoic acid (PubChem CID 55176539) has the molecular formula C11H8BrN3O3S and a molecular weight of 342.17 g/mol. Its IUPAC name is 2-[(2-amino-1,3-thiazole-4-carbonyl)amino]-3-bromobenzoic acid.

Molecular Properties

Compound Name2-[(2-amino-1,3-thiazole-4-carbonyl)amino]-3-bromobenzoic acid
PubChem CID55176539
Molecular FormulaC11H8BrN3O3S
Molecular Weight342.17 g/mol
Exact Mass340.95
IUPAC Name2-[(2-amino-1,3-thiazole-4-carbonyl)amino]-3-bromobenzoic acid
SMILESNc1nc(C(=O)Nc2c(Br)cccc2C(=O)O)cs1
InChIInChI=1S/C11H8BrN3O3S/c12-6-3-1-2-5(10(17)18)8(6)15-9(16)7-4-19-11(13)14-7/h1-4H,(H2,13,14)(H,15,16)(H,17,18)
InChIKeyBAFARHFOQBVSNQ-UHFFFAOYSA-N
XLogP2.44
TPSA105.31 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500342.17
LogP ≤ 52.44
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Analyze 2-[(2-amino-1,3-thiazole-4-carbonyl)amino]-3-bromobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(2-amino-1,3-thiazole-4-carbonyl)amino]-3-bromobenzoic acid?
The IUPAC name of 2-[(2-amino-1,3-thiazole-4-carbonyl)amino]-3-bromobenzoic acid (CID 55176539) is 2-[(2-amino-1,3-thiazole-4-carbonyl)amino]-3-bromobenzoic acid.
What is the SMILES notation for 2-[(2-amino-1,3-thiazole-4-carbonyl)amino]-3-bromobenzoic acid?
The canonical SMILES for 2-[(2-amino-1,3-thiazole-4-carbonyl)amino]-3-bromobenzoic acid is Nc1nc(C(=O)Nc2c(Br)cccc2C(=O)O)cs1.
What is the InChIKey of 2-[(2-amino-1,3-thiazole-4-carbonyl)amino]-3-bromobenzoic acid?
The InChIKey is BAFARHFOQBVSNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8BrN3O3S/c12-6-3-1-2-5(10(17)18)8(6)15-9(16)7-4-19-11(13)14-7/h1-4H,(H2,13,14)(H,15,16)(H,17,18).
What are the key properties of 2-[(2-amino-1,3-thiazole-4-carbonyl)amino]-3-bromobenzoic acid?
2-[(2-amino-1,3-thiazole-4-carbonyl)amino]-3-bromobenzoic acid has a molecular weight of 342.17 g/mol, XLogP of 2.44, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-amino-1,3-thiazole-4-carbonyl)amino]-3-bromobenzoic acid is sourced from PubChem (CID 55176539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).