C11H8BrN3O3S — CID 55176539
2-[(2-amino-1,3-thiazole-4-carbonyl)amino]-3-bromobenzoic acid (PubChem CID 55176539) has the molecular formula C11H8BrN3O3S and a molecular weight of 342.17 g/mol. Its IUPAC name is 2-[(2-amino-1,3-thiazole-4-carbonyl)amino]-3-bromobenzoic acid.
| Compound Name | 2-[(2-amino-1,3-thiazole-4-carbonyl)amino]-3-bromobenzoic acid |
|---|---|
| PubChem CID | 55176539 |
| Molecular Formula | C11H8BrN3O3S |
| Molecular Weight | 342.17 g/mol |
| Exact Mass | 340.95 |
| IUPAC Name | 2-[(2-amino-1,3-thiazole-4-carbonyl)amino]-3-bromobenzoic acid |
| SMILES | Nc1nc(C(=O)Nc2c(Br)cccc2C(=O)O)cs1 |
| InChI | InChI=1S/C11H8BrN3O3S/c12-6-3-1-2-5(10(17)18)8(6)15-9(16)7-4-19-11(13)14-7/h1-4H,(H2,13,14)(H,15,16)(H,17,18) |
| InChIKey | BAFARHFOQBVSNQ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.17 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |