C10H6Br2ClN3OS — CID 114209117
2-amino-N-(2,6-dibromo-4-chlorophenyl)-1,3-thiazole-4-carboxamide (PubChem CID 114209117) has the molecular formula C10H6Br2ClN3OS and a molecular weight of 411.51 g/mol. Its IUPAC name is 2-amino-N-(2,6-dibromo-4-chlorophenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-amino-N-(2,6-dibromo-4-chlorophenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 114209117 |
| Molecular Formula | C10H6Br2ClN3OS |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 408.83 |
| IUPAC Name | 2-amino-N-(2,6-dibromo-4-chlorophenyl)-1,3-thiazole-4-carboxamide |
| SMILES | Nc1nc(C(=O)Nc2c(Br)cc(Cl)cc2Br)cs1 |
| InChI | InChI=1S/C10H6Br2ClN3OS/c11-5-1-4(13)2-6(12)8(5)16-9(17)7-3-18-10(14)15-7/h1-3H,(H2,14,15)(H,16,17) |
| InChIKey | JKSPRDUSXGJSJB-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |