C10H6BrCl2N3OS — CID 55116387
2-amino-N-(4-bromo-2,6-dichlorophenyl)-1,3-thiazole-4-carboxamide (PubChem CID 55116387) has the molecular formula C10H6BrCl2N3OS and a molecular weight of 367.06 g/mol. Its IUPAC name is 2-amino-N-(4-bromo-2,6-dichlorophenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-amino-N-(4-bromo-2,6-dichlorophenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 55116387 |
| Molecular Formula | C10H6BrCl2N3OS |
| Molecular Weight | 367.06 g/mol |
| Exact Mass | 364.88 |
| IUPAC Name | 2-amino-N-(4-bromo-2,6-dichlorophenyl)-1,3-thiazole-4-carboxamide |
| SMILES | Nc1nc(C(=O)Nc2c(Cl)cc(Br)cc2Cl)cs1 |
| InChI | InChI=1S/C10H6BrCl2N3OS/c11-4-1-5(12)8(6(13)2-4)16-9(17)7-3-18-10(14)15-7/h1-3H,(H2,14,15)(H,16,17) |
| InChIKey | JWKNVUMOZZCEMR-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.06 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |