C14H10BrN3OS — CID 81259724
2-amino-N-(6-bromonaphthalen-2-yl)-1,3-thiazole-4-carboxamide (PubChem CID 81259724) has the molecular formula C14H10BrN3OS and a molecular weight of 348.23 g/mol. Its IUPAC name is 2-amino-N-(6-bromonaphthalen-2-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-amino-N-(6-bromonaphthalen-2-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 81259724 |
| Molecular Formula | C14H10BrN3OS |
| Molecular Weight | 348.23 g/mol |
| Exact Mass | 346.97 |
| IUPAC Name | 2-amino-N-(6-bromonaphthalen-2-yl)-1,3-thiazole-4-carboxamide |
| SMILES | Nc1nc(C(=O)Nc2ccc3cc(Br)ccc3c2)cs1 |
| InChI | InChI=1S/C14H10BrN3OS/c15-10-3-1-9-6-11(4-2-8(9)5-10)17-13(19)12-7-20-14(16)18-12/h1-7H,(H2,16,18)(H,17,19) |
| InChIKey | VACMWFKPBONZHY-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.23 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |