C12H12N4O2S — CID 62788909
2-amino-N-[4-(methylcarbamoyl)phenyl]-1,3-thiazole-4-carboxamide (PubChem CID 62788909) has the molecular formula C12H12N4O2S and a molecular weight of 276.32 g/mol. Its IUPAC name is 2-amino-N-[4-(methylcarbamoyl)phenyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-amino-N-[4-(methylcarbamoyl)phenyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 62788909 |
| Molecular Formula | C12H12N4O2S |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 2-amino-N-[4-(methylcarbamoyl)phenyl]-1,3-thiazole-4-carboxamide |
| SMILES | CNC(=O)c1ccc(NC(=O)c2csc(N)n2)cc1 |
| InChI | InChI=1S/C12H12N4O2S/c1-14-10(17)7-2-4-8(5-3-7)15-11(18)9-6-19-12(13)16-9/h2-6H,1H3,(H2,13,16)(H,14,17)(H,15,18) |
| InChIKey | HDEIXUGCCRPTME-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |