C10H8N4O3S — CID 62788018
2-amino-N-(4-nitrophenyl)-1,3-thiazole-4-carboxamide (PubChem CID 62788018) has the molecular formula C10H8N4O3S and a molecular weight of 264.27 g/mol. Its IUPAC name is 2-amino-N-(4-nitrophenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-amino-N-(4-nitrophenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 62788018 |
| Molecular Formula | C10H8N4O3S |
| Molecular Weight | 264.27 g/mol |
| Exact Mass | 264.03 |
| IUPAC Name | 2-amino-N-(4-nitrophenyl)-1,3-thiazole-4-carboxamide |
| SMILES | Nc1nc(C(=O)Nc2ccc([N+](=O)[O-])cc2)cs1 |
| InChI | InChI=1S/C10H8N4O3S/c11-10-13-8(5-18-10)9(15)12-6-1-3-7(4-2-6)14(16)17/h1-5H,(H2,11,13)(H,12,15) |
| InChIKey | CUOGZJCYYNGTAL-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 111.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.27 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|