C14H9N3O3S2 — CID 43032437
N-(4-nitrophenyl)-2-thiophen-2-yl-1,3-thiazole-4-carboxamide (PubChem CID 43032437) has the molecular formula C14H9N3O3S2 and a molecular weight of 331.38 g/mol. Its IUPAC name is N-(4-nitrophenyl)-2-thiophen-2-yl-1,3-thiazole-4-carboxamide.
| Compound Name | N-(4-nitrophenyl)-2-thiophen-2-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 43032437 |
| Molecular Formula | C14H9N3O3S2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.01 |
| IUPAC Name | N-(4-nitrophenyl)-2-thiophen-2-yl-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1)c1csc(-c2cccs2)n1 |
| InChI | InChI=1S/C14H9N3O3S2/c18-13(15-9-3-5-10(6-4-9)17(19)20)11-8-22-14(16-11)12-2-1-7-21-12/h1-8H,(H,15,18) |
| InChIKey | SCVPUYPECRXOOT-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|